Fatty acids C14-C18 and C16-C18 unsaturated
Catalog No: FT-0626391
CAS No: 67701-06-8
- Chemical Name: Fatty acids C14-C18 and C16-C18 unsaturated
- Molecular Formula: C15H16O2
- Molecular Weight: 228.29
- InChI Key: DTAMQBQGFSVRFE-IDFWPVMJSA-N
- InChI: InChI=1S/C15H16O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h2-14H,1H2,(H,16,17)/b4-3+,6-5+,8-7+,10-9+,12-11+,14-13+
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | N/A |
|---|---|
| CAS: | 67701-06-8 |
| MF: | C15H16O2 |
| Flash_Point: | 200ºC |
| Product_Name: | (2E,4E,6E,8E,10E,12E)-pentadeca-2,4,6,8,10,12,14-heptaenoic acid |
| Density: | 1.003g/cm3 |
| FW: | 228.28600 |
| Bolling_Point: | 435.3ºC at 760 mmHg |
| Refractive_Index: | 1.556 |
|---|---|
| MF: | C15H16O2 |
| Flash_Point: | 200ºC |
| LogP: | 3.59420 |
| FW: | 228.28600 |
| Density: | 1.003g/cm3 |
| PSA: | 37.30000 |
| Bolling_Point: | 435.3ºC at 760 mmHg |
| Exact_Mass: | 228.11500 |
Related Products
Acetamide, N-[(6R)-6-amino-4,5,6,7-tetrahydro-2-benzothiazolyl]-
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-